About 4-butoxy-N-[2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-oxoethyl]benzamide
4-butoxy-N-[2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-oxoethyl]benzamide (PubChem CID 25163781) has the molecular formula C21H30N4O3
and a molecular weight of 386.50 g/mol. Its IUPAC name is 4-butoxy-N-[2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-oxoethyl]benzamide.
Molecular Properties
| Compound Name | 4-butoxy-N-[2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-oxoethyl]benzamide |
| PubChem CID | 25163781 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | 4-butoxy-N-[2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-oxoethyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NCC(=O)NCCCn2nc(C)cc2C)cc1 |
| InChI | InChI=1S/C21H30N4O3/c1-4-5-13-28-19-9-7-18(8-10-19)21(27)23-15-20(26)22-11-6-12-25-17(3)14-16(2)24-25/h7-10,14H,4-6,11-13,15H2,1-3H3,(H,22,26)(H,23,27) |
| InChIKey | XPVPAAOFPYTTBO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-butoxy-N-[2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-oxoethyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butoxy-N-[2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-oxoethyl]benzamide?
The IUPAC name of 4-butoxy-N-[2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-oxoethyl]benzamide (CID 25163781) is 4-butoxy-N-[2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-oxoethyl]benzamide.
What is the SMILES notation for 4-butoxy-N-[2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-oxoethyl]benzamide?
The canonical SMILES for 4-butoxy-N-[2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-oxoethyl]benzamide is CCCCOc1ccc(C(=O)NCC(=O)NCCCn2nc(C)cc2C)cc1.
What is the InChIKey of 4-butoxy-N-[2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-oxoethyl]benzamide?
The InChIKey is XPVPAAOFPYTTBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30N4O3/c1-4-5-13-28-19-9-7-18(8-10-19)21(27)23-15-20(26)22-11-6-12-25-17(3)14-16(2)24-25/h7-10,14H,4-6,11-13,15H2,1-3H3,(H,22,26)(H,23,27).
What are the key properties of 4-butoxy-N-[2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-oxoethyl]benzamide?
4-butoxy-N-[2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-oxoethyl]benzamide has a molecular weight of 386.50 g/mol, XLogP of 2.62, 11 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butoxy-N-[2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-2-oxoethyl]benzamide is sourced from PubChem (CID 25163781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).