About [2-[(1,1-dioxothiolan-3-yl)-propylamino]-2-oxoethyl] 2-(4-nitrophenyl)sulfanylacetate
[2-[(1,1-dioxothiolan-3-yl)-propylamino]-2-oxoethyl] 2-(4-nitrophenyl)sulfanylacetate (PubChem CID 25163797) has the molecular formula C17H22N2O7S2
and a molecular weight of 430.50 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)-propylamino]-2-oxoethyl] 2-(4-nitrophenyl)sulfanylacetate.
Molecular Properties
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)-propylamino]-2-oxoethyl] 2-(4-nitrophenyl)sulfanylacetate |
| PubChem CID | 25163797 |
| Molecular Formula | C17H22N2O7S2 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)-propylamino]-2-oxoethyl] 2-(4-nitrophenyl)sulfanylacetate |
| SMILES | CCCN(C(=O)COC(=O)CSc1ccc([N+](=O)[O-])cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H22N2O7S2/c1-2-8-18(14-7-9-28(24,25)12-14)16(20)10-26-17(21)11-27-15-5-3-13(4-6-15)19(22)23/h3-6,14H,2,7-12H2,1H3 |
| InChIKey | SGGABVMKJZXTBL-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-[(1,1-dioxothiolan-3-yl)-propylamino]-2-oxoethyl] 2-(4-nitrophenyl)sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(1,1-dioxothiolan-3-yl)-propylamino]-2-oxoethyl] 2-(4-nitrophenyl)sulfanylacetate?
The IUPAC name of [2-[(1,1-dioxothiolan-3-yl)-propylamino]-2-oxoethyl] 2-(4-nitrophenyl)sulfanylacetate (CID 25163797) is [2-[(1,1-dioxothiolan-3-yl)-propylamino]-2-oxoethyl] 2-(4-nitrophenyl)sulfanylacetate.
What is the SMILES notation for [2-[(1,1-dioxothiolan-3-yl)-propylamino]-2-oxoethyl] 2-(4-nitrophenyl)sulfanylacetate?
The canonical SMILES for [2-[(1,1-dioxothiolan-3-yl)-propylamino]-2-oxoethyl] 2-(4-nitrophenyl)sulfanylacetate is CCCN(C(=O)COC(=O)CSc1ccc([N+](=O)[O-])cc1)C1CCS(=O)(=O)C1.
What is the InChIKey of [2-[(1,1-dioxothiolan-3-yl)-propylamino]-2-oxoethyl] 2-(4-nitrophenyl)sulfanylacetate?
The InChIKey is SGGABVMKJZXTBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O7S2/c1-2-8-18(14-7-9-28(24,25)12-14)16(20)10-26-17(21)11-27-15-5-3-13(4-6-15)19(22)23/h3-6,14H,2,7-12H2,1H3.
What are the key properties of [2-[(1,1-dioxothiolan-3-yl)-propylamino]-2-oxoethyl] 2-(4-nitrophenyl)sulfanylacetate?
[2-[(1,1-dioxothiolan-3-yl)-propylamino]-2-oxoethyl] 2-(4-nitrophenyl)sulfanylacetate has a molecular weight of 430.50 g/mol, XLogP of 1.66, 9 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(1,1-dioxothiolan-3-yl)-propylamino]-2-oxoethyl] 2-(4-nitrophenyl)sulfanylacetate is sourced from PubChem (CID 25163797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).