About 3-chloro-N-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-1-benzothiophene-2-carboxamide
3-chloro-N-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-1-benzothiophene-2-carboxamide (PubChem CID 25163811) has the molecular formula C18H21ClN2O2S
and a molecular weight of 364.90 g/mol. Its IUPAC name is 3-chloro-N-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-1-benzothiophene-2-carboxamide.
Molecular Properties
| Compound Name | 3-chloro-N-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-1-benzothiophene-2-carboxamide |
| PubChem CID | 25163811 |
| Molecular Formula | C18H21ClN2O2S |
| Molecular Weight | 364.90 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 3-chloro-N-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-1-benzothiophene-2-carboxamide |
| SMILES | CC1CC(C)CN(C(=O)CNC(=O)c2sc3ccccc3c2Cl)C1 |
| InChI | InChI=1S/C18H21ClN2O2S/c1-11-7-12(2)10-21(9-11)15(22)8-20-18(23)17-16(19)13-5-3-4-6-14(13)24-17/h3-6,11-12H,7-10H2,1-2H3,(H,20,23) |
| InChIKey | ZWHPDCMVYSWGIE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.90 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-chloro-N-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-1-benzothiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-1-benzothiophene-2-carboxamide?
The IUPAC name of 3-chloro-N-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-1-benzothiophene-2-carboxamide (CID 25163811) is 3-chloro-N-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-1-benzothiophene-2-carboxamide.
What is the SMILES notation for 3-chloro-N-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-1-benzothiophene-2-carboxamide?
The canonical SMILES for 3-chloro-N-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-1-benzothiophene-2-carboxamide is CC1CC(C)CN(C(=O)CNC(=O)c2sc3ccccc3c2Cl)C1.
What is the InChIKey of 3-chloro-N-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-1-benzothiophene-2-carboxamide?
The InChIKey is ZWHPDCMVYSWGIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21ClN2O2S/c1-11-7-12(2)10-21(9-11)15(22)8-20-18(23)17-16(19)13-5-3-4-6-14(13)24-17/h3-6,11-12H,7-10H2,1-2H3,(H,20,23).
What are the key properties of 3-chloro-N-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-1-benzothiophene-2-carboxamide?
3-chloro-N-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-1-benzothiophene-2-carboxamide has a molecular weight of 364.90 g/mol, XLogP of 3.79, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-1-benzothiophene-2-carboxamide is sourced from PubChem (CID 25163811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).