C25H49N3O4S — CID 25163980
(2R,4S,5S)-N-butyl-4-hydroxy-2,7-dimethyl-5-[[(2S)-2-(4-methylpentanoylamino)-4-methylsulfanylbutanoyl]amino]octanamide (PubChem CID 25163980) has the molecular formula C25H49N3O4S and a molecular weight of 487.75 g/mol. Its IUPAC name is (2R,4S,5S)-N-butyl-4-hydroxy-2,7-dimethyl-5-[[(2S)-2-(4-methylpentanoylamino)-4-methylsulfanylbutanoyl]amino]octanamide.
| Compound Name | (2R,4S,5S)-N-butyl-4-hydroxy-2,7-dimethyl-5-[[(2S)-2-(4-methylpentanoylamino)-4-methylsulfanylbutanoyl]amino]octanamide |
|---|---|
| PubChem CID | 25163980 |
| Molecular Formula | C25H49N3O4S |
| Molecular Weight | 487.75 g/mol |
| Exact Mass | 487.34 |
| IUPAC Name | (2R,4S,5S)-N-butyl-4-hydroxy-2,7-dimethyl-5-[[(2S)-2-(4-methylpentanoylamino)-4-methylsulfanylbutanoyl]amino]octanamide |
| SMILES | CCCCNC(=O)[C@H](C)C[C@H](O)[C@H](CC(C)C)NC(=O)[C@H](CCSC)NC(=O)CCC(C)C |
| InChI | InChI=1S/C25H49N3O4S/c1-8-9-13-26-24(31)19(6)16-22(29)21(15-18(4)5)28-25(32)20(12-14-33-7)27-23(30)11-10-17(2)3/h17-22,29H,8-16H2,1-7H3,(H,26,31)(H,27,30)(H,28,32)/t19-,20+,21+,22+/m1/s1 |
| InChIKey | XTRMRNMVFXWTCC-MLNNCEHLSA-N |
| XLogP | 3.49 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.75 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|