C22H29NO4 — CID 25164508
(13S,13aR)-2,3,9,10-tetramethoxy-13-methyl-3,5,6,8,13,13a-hexahydro-2H-isoquinolino[2,1-b]isoquinoline (PubChem CID 25164508) has the molecular formula C22H29NO4 and a molecular weight of 371.48 g/mol. Its IUPAC name is (13S,13aR)-2,3,9,10-tetramethoxy-13-methyl-3,5,6,8,13,13a-hexahydro-2H-isoquinolino[2,1-b]isoquinoline.
| Compound Name | (13S,13aR)-2,3,9,10-tetramethoxy-13-methyl-3,5,6,8,13,13a-hexahydro-2H-isoquinolino[2,1-b]isoquinoline |
|---|---|
| PubChem CID | 25164508 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | (13S,13aR)-2,3,9,10-tetramethoxy-13-methyl-3,5,6,8,13,13a-hexahydro-2H-isoquinolino[2,1-b]isoquinoline |
| SMILES | COc1ccc2c(c1OC)CN1CCC3=CC(OC)C(OC)C=C3[C@H]1[C@H]2C |
| InChI | InChI=1S/C22H29NO4/c1-13-15-6-7-18(24-2)22(27-5)17(15)12-23-9-8-14-10-19(25-3)20(26-4)11-16(14)21(13)23/h6-7,10-11,13,19-21H,8-9,12H2,1-5H3/t13-,19?,20?,21+/m0/s1 |
| InChIKey | QLMZXSFNZRRYGE-ZNZFDGANSA-N |
| XLogP | 3.29 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |