C22H31N3 — CID 25164613
(1R,12R,16R)-13-(cyclopropylmethyl)-1,16-dimethyl-6-propan-2-yl-5,7,13-triazatetracyclo[10.3.1.02,10.04,8]hexadeca-2,4(8),5,9-tetraene (PubChem CID 25164613) has the molecular formula C22H31N3 and a molecular weight of 337.51 g/mol. Its IUPAC name is (1R,12R,16R)-13-(cyclopropylmethyl)-1,16-dimethyl-6-propan-2-yl-5,7,13-triazatetracyclo[10.3.1.02,10.04,8]hexadeca-2,4(8),5,9-tetraene.
| Compound Name | (1R,12R,16R)-13-(cyclopropylmethyl)-1,16-dimethyl-6-propan-2-yl-5,7,13-triazatetracyclo[10.3.1.02,10.04,8]hexadeca-2,4(8),5,9-tetraene |
|---|---|
| PubChem CID | 25164613 |
| Molecular Formula | C22H31N3 |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.25 |
| IUPAC Name | (1R,12R,16R)-13-(cyclopropylmethyl)-1,16-dimethyl-6-propan-2-yl-5,7,13-triazatetracyclo[10.3.1.02,10.04,8]hexadeca-2,4(8),5,9-tetraene |
| SMILES | CC(C)c1nc2cc3c(cc2[nH]1)C[C@@H]1[C@H](C)[C@@]3(C)CCN1CC1CC1 |
| InChI | InChI=1S/C22H31N3/c1-13(2)21-23-18-9-16-10-20-14(3)22(4,17(16)11-19(18)24-21)7-8-25(20)12-15-5-6-15/h9,11,13-15,20H,5-8,10,12H2,1-4H3,(H,23,24)/t14-,20+,22+/m0/s1 |
| InChIKey | ZHGKCUUAKXCULV-UPNLOYSTSA-N |
| XLogP | 4.62 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |