About 7,8-dimethoxy-5-methylbenzo[c]phenanthridin-5-ium-2,3-diol chloride
7,8-dimethoxy-5-methylbenzo[c]phenanthridin-5-ium-2,3-diol chloride (PubChem CID 25164618) has the molecular formula C20H18ClNO4
and a molecular weight of 371.82 g/mol. Its IUPAC name is 7,8-dimethoxy-5-methylbenzo[c]phenanthridin-5-ium-2,3-diol chloride.
Molecular Properties
| Compound Name | 7,8-dimethoxy-5-methylbenzo[c]phenanthridin-5-ium-2,3-diol chloride |
| PubChem CID | 25164618 |
| Molecular Formula | C20H18ClNO4 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 7,8-dimethoxy-5-methylbenzo[c]phenanthridin-5-ium-2,3-diol chloride |
| SMILES | COc1ccc2c(c[n+](C)c3c4cc(O)c(O)cc4ccc23)c1OC.[Cl-] |
| InChI | InChI=1S/C20H17NO4.ClH/c1-21-10-15-12(6-7-18(24-2)20(15)25-3)13-5-4-11-8-16(22)17(23)9-14(11)19(13)21;/h4-10,23H,1-3H3;1H |
| InChIKey | LBNLQYBVYOXOON-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 62.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 7,8-dimethoxy-5-methylbenzo[c]phenanthridin-5-ium-2,3-diol chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dimethoxy-5-methylbenzo[c]phenanthridin-5-ium-2,3-diol chloride?
The IUPAC name of 7,8-dimethoxy-5-methylbenzo[c]phenanthridin-5-ium-2,3-diol chloride (CID 25164618) is 7,8-dimethoxy-5-methylbenzo[c]phenanthridin-5-ium-2,3-diol chloride.
What is the SMILES notation for 7,8-dimethoxy-5-methylbenzo[c]phenanthridin-5-ium-2,3-diol chloride?
The canonical SMILES for 7,8-dimethoxy-5-methylbenzo[c]phenanthridin-5-ium-2,3-diol chloride is COc1ccc2c(c[n+](C)c3c4cc(O)c(O)cc4ccc23)c1OC.[Cl-].
What is the InChIKey of 7,8-dimethoxy-5-methylbenzo[c]phenanthridin-5-ium-2,3-diol chloride?
The InChIKey is LBNLQYBVYOXOON-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17NO4.ClH/c1-21-10-15-12(6-7-18(24-2)20(15)25-3)13-5-4-11-8-16(22)17(23)9-14(11)19(13)21;/h4-10,23H,1-3H3;1H.
What are the key properties of 7,8-dimethoxy-5-methylbenzo[c]phenanthridin-5-ium-2,3-diol chloride?
7,8-dimethoxy-5-methylbenzo[c]phenanthridin-5-ium-2,3-diol chloride has a molecular weight of 371.82 g/mol, XLogP of 0.40, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dimethoxy-5-methylbenzo[c]phenanthridin-5-ium-2,3-diol chloride is sourced from PubChem (CID 25164618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).