C22H20ClF5O6S2 — CID 25164810
(4S,4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-4-[2-(2,2,2-trifluoroethylsulfonyl)ethyl]-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromene (PubChem CID 25164810) has the molecular formula C22H20ClF5O6S2 and a molecular weight of 574.97 g/mol. Its IUPAC name is (4S,4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-4-[2-(2,2,2-trifluoroethylsulfonyl)ethyl]-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromene.
| Compound Name | (4S,4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-4-[2-(2,2,2-trifluoroethylsulfonyl)ethyl]-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromene |
|---|---|
| PubChem CID | 25164810 |
| Molecular Formula | C22H20ClF5O6S2 |
| Molecular Weight | 574.97 g/mol |
| Exact Mass | 574.03 |
| IUPAC Name | (4S,4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-4-[2-(2,2,2-trifluoroethylsulfonyl)ethyl]-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromene |
| SMILES | O=S(=O)(CC[C@@H]1OCC[C@@]2(S(=O)(=O)c3ccc(Cl)cc3)c3c(F)ccc(F)c3OC[C@@H]12)CC(F)(F)F |
| InChI | InChI=1S/C22H20ClF5O6S2/c23-13-1-3-14(4-2-13)36(31,32)21-8-9-33-18(7-10-35(29,30)12-22(26,27)28)15(21)11-34-20-17(25)6-5-16(24)19(20)21/h1-6,15,18H,7-12H2/t15-,18-,21-/m0/s1 |
| InChIKey | ZJPZMPHSVPDESN-XERREHJYSA-N |
| XLogP | 4.45 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.97 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |