C19H18ClNO5 — CID 2516516
[2-(3,5-dimethoxyanilino)-2-oxoethyl] (E)-3-(4-chlorophenyl)prop-2-enoate (PubChem CID 2516516) has the molecular formula C19H18ClNO5 and a molecular weight of 375.81 g/mol. Its IUPAC name is [2-(3,5-dimethoxyanilino)-2-oxoethyl] (E)-3-(4-chlorophenyl)prop-2-enoate.
| Compound Name | [2-(3,5-dimethoxyanilino)-2-oxoethyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2516516 |
| Molecular Formula | C19H18ClNO5 |
| Molecular Weight | 375.81 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | [2-(3,5-dimethoxyanilino)-2-oxoethyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
| SMILES | COc1cc(NC(=O)COC(=O)/C=C/c2ccc(Cl)cc2)cc(OC)c1 |
| InChI | InChI=1S/C19H18ClNO5/c1-24-16-9-15(10-17(11-16)25-2)21-18(22)12-26-19(23)8-5-13-3-6-14(20)7-4-13/h3-11H,12H2,1-2H3,(H,21,22)/b8-5+ |
| InChIKey | LQNHCDJZRKAQMZ-VMPITWQZSA-N |
| XLogP | 3.55 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.81 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|