C24H27F6N5O5 — CID 25165197
N-(4-carbamimidoylphenyl)-N'-[1-[4-(2-methoxyethylamino)-3-(trifluoromethyl)phenyl]ethyl]propanediamide;2,2,2-trifluoroacetic acid (PubChem CID 25165197) has the molecular formula C24H27F6N5O5 and a molecular weight of 579.50 g/mol. Its IUPAC name is N-(4-carbamimidoylphenyl)-N'-[1-[4-(2-methoxyethylamino)-3-(trifluoromethyl)phenyl]ethyl]propanediamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-(4-carbamimidoylphenyl)-N'-[1-[4-(2-methoxyethylamino)-3-(trifluoromethyl)phenyl]ethyl]propanediamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 25165197 |
| Molecular Formula | C24H27F6N5O5 |
| Molecular Weight | 579.50 g/mol |
| Exact Mass | 579.19 |
| IUPAC Name | N-(4-carbamimidoylphenyl)-N'-[1-[4-(2-methoxyethylamino)-3-(trifluoromethyl)phenyl]ethyl]propanediamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(NC(=O)CC(=O)NC(C)c2ccc(NCCOC)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C22H26F3N5O3.C2HF3O2/c1-13(15-5-8-18(28-9-10-33-2)17(11-15)22(23,24)25)29-19(31)12-20(32)30-16-6-3-14(4-7-16)21(26)27;3-2(4,5)1(6)7/h3-8,11,13,28H,9-10,12H2,1-2H3,(H3,26,27)(H,29,31)(H,30,32);(H,6,7) |
| InChIKey | JOMCUKORRYDKRB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 166.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|