C17H19ClNO4+ — CID 25165618
5,6,7,8,13,13a-hexahydroisoquinolino[2,1-b]isoquinolin-7-ium-2,3,9,10-tetrol;hydrochloride (PubChem CID 25165618) has the molecular formula C17H19ClNO4+ and a molecular weight of 336.80 g/mol. Its IUPAC name is 5,6,7,8,13,13a-hexahydroisoquinolino[2,1-b]isoquinolin-7-ium-2,3,9,10-tetrol;hydrochloride.
| Compound Name | 5,6,7,8,13,13a-hexahydroisoquinolino[2,1-b]isoquinolin-7-ium-2,3,9,10-tetrol;hydrochloride |
|---|---|
| PubChem CID | 25165618 |
| Molecular Formula | C17H19ClNO4+ |
| Molecular Weight | 336.80 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 5,6,7,8,13,13a-hexahydroisoquinolino[2,1-b]isoquinolin-7-ium-2,3,9,10-tetrol;hydrochloride |
| SMILES | Cl.Oc1cc2c(cc1O)C1Cc3ccc(O)c(O)c3C[NH+]1CC2 |
| InChI | InChI=1S/C17H17NO4.ClH/c19-14-2-1-9-5-13-11-7-16(21)15(20)6-10(11)3-4-18(13)8-12(9)17(14)22;/h1-2,6-7,13,19-22H,3-5,8H2;1H/p+1 |
| InChIKey | KTIPNRVQZXOPBP-UHFFFAOYSA-O |
| XLogP | 1.17 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.80 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|