C28H25F5O5S2 — CID 25166193
(6aR,7S,10aS)-7-[2-(benzenesulfonyl)ethyl]-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromene (PubChem CID 25166193) has the molecular formula C28H25F5O5S2 and a molecular weight of 600.63 g/mol. Its IUPAC name is (6aR,7S,10aS)-7-[2-(benzenesulfonyl)ethyl]-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromene.
| Compound Name | (6aR,7S,10aS)-7-[2-(benzenesulfonyl)ethyl]-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromene |
|---|---|
| PubChem CID | 25166193 |
| Molecular Formula | C28H25F5O5S2 |
| Molecular Weight | 600.63 g/mol |
| Exact Mass | 600.11 |
| IUPAC Name | (6aR,7S,10aS)-7-[2-(benzenesulfonyl)ethyl]-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromene |
| SMILES | O=S(=O)(CC[C@@H]1CCC[C@@]2(S(=O)(=O)c3ccc(C(F)(F)F)cc3)c3c(F)ccc(F)c3OC[C@@H]12)c1ccccc1 |
| InChI | InChI=1S/C28H25F5O5S2/c29-23-12-13-24(30)26-25(23)27(40(36,37)21-10-8-19(9-11-21)28(31,32)33)15-4-5-18(22(27)17-38-26)14-16-39(34,35)20-6-2-1-3-7-20/h1-3,6-13,18,22H,4-5,14-17H2/t18-,22-,27-/m0/s1 |
| InChIKey | PBFUTUYCYRCOSK-PUIUQNQWSA-N |
| XLogP | 6.33 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.63 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |