About 5-[1-[(2,5-dichlorophenyl)methyl]triazol-4-yl]-1H-indazole
5-[1-[(2,5-dichlorophenyl)methyl]triazol-4-yl]-1H-indazole (PubChem CID 25166659) has the molecular formula C16H11Cl2N5
and a molecular weight of 344.21 g/mol. Its IUPAC name is 5-[1-[(2,5-dichlorophenyl)methyl]triazol-4-yl]-1H-indazole.
Molecular Properties
| Compound Name | 5-[1-[(2,5-dichlorophenyl)methyl]triazol-4-yl]-1H-indazole |
| PubChem CID | 25166659 |
| Molecular Formula | C16H11Cl2N5 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 5-[1-[(2,5-dichlorophenyl)methyl]triazol-4-yl]-1H-indazole |
| SMILES | Clc1ccc(Cl)c(Cn2cc(-c3ccc4[nH]ncc4c3)nn2)c1 |
| InChI | InChI=1S/C16H11Cl2N5/c17-13-2-3-14(18)12(6-13)8-23-9-16(21-22-23)10-1-4-15-11(5-10)7-19-20-15/h1-7,9H,8H2,(H,19,20) |
| InChIKey | XEBSFQDAOYDIMU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[1-[(2,5-dichlorophenyl)methyl]triazol-4-yl]-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-[(2,5-dichlorophenyl)methyl]triazol-4-yl]-1H-indazole?
The IUPAC name of 5-[1-[(2,5-dichlorophenyl)methyl]triazol-4-yl]-1H-indazole (CID 25166659) is 5-[1-[(2,5-dichlorophenyl)methyl]triazol-4-yl]-1H-indazole.
What is the SMILES notation for 5-[1-[(2,5-dichlorophenyl)methyl]triazol-4-yl]-1H-indazole?
The canonical SMILES for 5-[1-[(2,5-dichlorophenyl)methyl]triazol-4-yl]-1H-indazole is Clc1ccc(Cl)c(Cn2cc(-c3ccc4[nH]ncc4c3)nn2)c1.
What is the InChIKey of 5-[1-[(2,5-dichlorophenyl)methyl]triazol-4-yl]-1H-indazole?
The InChIKey is XEBSFQDAOYDIMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11Cl2N5/c17-13-2-3-14(18)12(6-13)8-23-9-16(21-22-23)10-1-4-15-11(5-10)7-19-20-15/h1-7,9H,8H2,(H,19,20).
What are the key properties of 5-[1-[(2,5-dichlorophenyl)methyl]triazol-4-yl]-1H-indazole?
5-[1-[(2,5-dichlorophenyl)methyl]triazol-4-yl]-1H-indazole has a molecular weight of 344.21 g/mol, XLogP of 4.18, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-[(2,5-dichlorophenyl)methyl]triazol-4-yl]-1H-indazole is sourced from PubChem (CID 25166659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).