C35H52N4O5 — CID 25166820
3-[(2S,4R,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-2-yl]-2,2-dimethyl-1-(4-methylpiperazin-1-yl)propan-1-one (PubChem CID 25166820) has the molecular formula C35H52N4O5 and a molecular weight of 608.82 g/mol. Its IUPAC name is 3-[(2S,4R,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-2-yl]-2,2-dimethyl-1-(4-methylpiperazin-1-yl)propan-1-one.
| Compound Name | 3-[(2S,4R,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-2-yl]-2,2-dimethyl-1-(4-methylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 25166820 |
| Molecular Formula | C35H52N4O5 |
| Molecular Weight | 608.82 g/mol |
| Exact Mass | 608.39 |
| IUPAC Name | 3-[(2S,4R,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-2-yl]-2,2-dimethyl-1-(4-methylpiperazin-1-yl)propan-1-one |
| SMILES | COCCCN1CCOc2ccc(CO[C@H]3CN[C@H](CC(C)(C)C(=O)N4CCN(C)CC4)C[C@@H]3c3ccc(OC)cc3)cc21 |
| InChI | InChI=1S/C35H52N4O5/c1-35(2,34(40)39-16-14-37(3)15-17-39)23-28-22-30(27-8-10-29(42-5)11-9-27)33(24-36-28)44-25-26-7-12-32-31(21-26)38(18-20-43-32)13-6-19-41-4/h7-12,21,28,30,33,36H,6,13-20,22-25H2,1-5H3/t28-,30+,33-/m0/s1 |
| InChIKey | FAODGYFDESFRTR-HCJVQNJKSA-N |
| XLogP | 4.15 |
| TPSA | 75.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.82 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|