About 1-benzylspiro[piperidine-4,4'-thieno[3,2-c]pyran]
1-benzylspiro[piperidine-4,4'-thieno[3,2-c]pyran] (PubChem CID 25166886) has the molecular formula C18H19NOS
and a molecular weight of 297.42 g/mol. Its IUPAC name is 1-benzylspiro[piperidine-4,4'-thieno[3,2-c]pyran].
Molecular Properties
| Compound Name | 1-benzylspiro[piperidine-4,4'-thieno[3,2-c]pyran] |
| PubChem CID | 25166886 |
| Molecular Formula | C18H19NOS |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 1-benzylspiro[piperidine-4,4'-thieno[3,2-c]pyran] |
| SMILES | C1=Cc2sccc2C2(CCN(Cc3ccccc3)CC2)O1 |
| InChI | InChI=1S/C18H19NOS/c1-2-4-15(5-3-1)14-19-10-8-18(9-11-19)16-7-13-21-17(16)6-12-20-18/h1-7,12-13H,8-11,14H2 |
| InChIKey | JBWDEMHZFXVMEO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-benzylspiro[piperidine-4,4'-thieno[3,2-c]pyran] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzylspiro[piperidine-4,4'-thieno[3,2-c]pyran]?
The IUPAC name of 1-benzylspiro[piperidine-4,4'-thieno[3,2-c]pyran] (CID 25166886) is 1-benzylspiro[piperidine-4,4'-thieno[3,2-c]pyran].
What is the SMILES notation for 1-benzylspiro[piperidine-4,4'-thieno[3,2-c]pyran]?
The canonical SMILES for 1-benzylspiro[piperidine-4,4'-thieno[3,2-c]pyran] is C1=Cc2sccc2C2(CCN(Cc3ccccc3)CC2)O1.
What is the InChIKey of 1-benzylspiro[piperidine-4,4'-thieno[3,2-c]pyran]?
The InChIKey is JBWDEMHZFXVMEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NOS/c1-2-4-15(5-3-1)14-19-10-8-18(9-11-19)16-7-13-21-17(16)6-12-20-18/h1-7,12-13H,8-11,14H2.
What are the key properties of 1-benzylspiro[piperidine-4,4'-thieno[3,2-c]pyran]?
1-benzylspiro[piperidine-4,4'-thieno[3,2-c]pyran] has a molecular weight of 297.42 g/mol, XLogP of 4.24, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzylspiro[piperidine-4,4'-thieno[3,2-c]pyran] is sourced from PubChem (CID 25166886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).