C18H21NOS — CID 25167087
1'-benzylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine] (PubChem CID 25167087) has the molecular formula C18H21NOS and a molecular weight of 299.44 g/mol. Its IUPAC name is 1'-benzylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine].
| Compound Name | 1'-benzylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine] |
|---|---|
| PubChem CID | 25167087 |
| Molecular Formula | C18H21NOS |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 1'-benzylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine] |
| SMILES | c1ccc(CN2CCC3(CC2)OCCc2sccc23)cc1 |
| InChI | InChI=1S/C18H21NOS/c1-2-4-15(5-3-1)14-19-10-8-18(9-11-19)16-7-13-21-17(16)6-12-20-18/h1-5,7,13H,6,8-12,14H2 |
| InChIKey | WRPOPKKINJVHKF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |