C29H23Cl2NO4 — CID 25167370
3-[6-[[3-(2,6-dichlorophenyl)-5-propan-2-yl-1,2-oxazol-4-yl]methoxy]-1H-inden-2-yl]benzoic acid (PubChem CID 25167370) has the molecular formula C29H23Cl2NO4 and a molecular weight of 520.41 g/mol. Its IUPAC name is 3-[6-[[3-(2,6-dichlorophenyl)-5-propan-2-yl-1,2-oxazol-4-yl]methoxy]-1H-inden-2-yl]benzoic acid.
| Compound Name | 3-[6-[[3-(2,6-dichlorophenyl)-5-propan-2-yl-1,2-oxazol-4-yl]methoxy]-1H-inden-2-yl]benzoic acid |
|---|---|
| PubChem CID | 25167370 |
| Molecular Formula | C29H23Cl2NO4 |
| Molecular Weight | 520.41 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | 3-[6-[[3-(2,6-dichlorophenyl)-5-propan-2-yl-1,2-oxazol-4-yl]methoxy]-1H-inden-2-yl]benzoic acid |
| SMILES | CC(C)c1onc(-c2c(Cl)cccc2Cl)c1COc1ccc2c(c1)CC(c1cccc(C(=O)O)c1)=C2 |
| InChI | InChI=1S/C29H23Cl2NO4/c1-16(2)28-23(27(32-36-28)26-24(30)7-4-8-25(26)31)15-35-22-10-9-18-12-20(13-21(18)14-22)17-5-3-6-19(11-17)29(33)34/h3-12,14,16H,13,15H2,1-2H3,(H,33,34) |
| InChIKey | BSROUIYEGFNTKN-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.41 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|