C25H26Cl2F3N7O3 — CID 25167443
4-N-[[4-[(3,5-dichloro-4-pyridinyl)methylamino]cyclohexyl]methyl]-5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-diamine (PubChem CID 25167443) has the molecular formula C25H26Cl2F3N7O3 and a molecular weight of 600.43 g/mol. Its IUPAC name is 4-N-[[4-[(3,5-dichloro-4-pyridinyl)methylamino]cyclohexyl]methyl]-5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-[[4-[(3,5-dichloro-4-pyridinyl)methylamino]cyclohexyl]methyl]-5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 25167443 |
| Molecular Formula | C25H26Cl2F3N7O3 |
| Molecular Weight | 600.43 g/mol |
| Exact Mass | 599.14 |
| IUPAC Name | 4-N-[[4-[(3,5-dichloro-4-pyridinyl)methylamino]cyclohexyl]methyl]-5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-diamine |
| SMILES | O=[N+]([O-])c1cnc(NCc2ccccc2OC(F)(F)F)nc1NCC1CCC(NCc2c(Cl)cncc2Cl)CC1 |
| InChI | InChI=1S/C25H26Cl2F3N7O3/c26-19-12-31-13-20(27)18(19)11-32-17-7-5-15(6-8-17)9-33-23-21(37(38)39)14-35-24(36-23)34-10-16-3-1-2-4-22(16)40-25(28,29)30/h1-4,12-15,17,32H,5-11H2,(H2,33,34,35,36) |
| InChIKey | IKCFZBQKXLGPHL-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 127.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.43 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|