C26H27F6N7O3 — CID 25167444
5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]-4-N-[[4-[[6-(trifluoromethyl)-3-pyridinyl]methylamino]cyclohexyl]methyl]pyrimidine-2,4-diamine (PubChem CID 25167444) has the molecular formula C26H27F6N7O3 and a molecular weight of 599.54 g/mol. Its IUPAC name is 5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]-4-N-[[4-[[6-(trifluoromethyl)-3-pyridinyl]methylamino]cyclohexyl]methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]-4-N-[[4-[[6-(trifluoromethyl)-3-pyridinyl]methylamino]cyclohexyl]methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 25167444 |
| Molecular Formula | C26H27F6N7O3 |
| Molecular Weight | 599.54 g/mol |
| Exact Mass | 599.21 |
| IUPAC Name | 5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]-4-N-[[4-[[6-(trifluoromethyl)-3-pyridinyl]methylamino]cyclohexyl]methyl]pyrimidine-2,4-diamine |
| SMILES | O=[N+]([O-])c1cnc(NCc2ccccc2OC(F)(F)F)nc1NCC1CCC(NCc2ccc(C(F)(F)F)nc2)CC1 |
| InChI | InChI=1S/C26H27F6N7O3/c27-25(28,29)22-10-7-17(13-34-22)12-33-19-8-5-16(6-9-19)11-35-23-20(39(40)41)15-37-24(38-23)36-14-18-3-1-2-4-21(18)42-26(30,31)32/h1-4,7,10,13,15-16,19,33H,5-6,8-9,11-12,14H2,(H2,35,36,37,38) |
| InChIKey | JSGUNDSERIVPAF-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 127.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.54 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|