C25H31F3N8O3 — CID 25167578
4-N-[[4-[(1,5-dimethylpyrazol-4-yl)methylamino]cyclohexyl]methyl]-5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-diamine (PubChem CID 25167578) has the molecular formula C25H31F3N8O3 and a molecular weight of 548.57 g/mol. Its IUPAC name is 4-N-[[4-[(1,5-dimethylpyrazol-4-yl)methylamino]cyclohexyl]methyl]-5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-[[4-[(1,5-dimethylpyrazol-4-yl)methylamino]cyclohexyl]methyl]-5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 25167578 |
| Molecular Formula | C25H31F3N8O3 |
| Molecular Weight | 548.57 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | 4-N-[[4-[(1,5-dimethylpyrazol-4-yl)methylamino]cyclohexyl]methyl]-5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-diamine |
| SMILES | Cc1c(CNC2CCC(CNc3nc(NCc4ccccc4OC(F)(F)F)ncc3[N+](=O)[O-])CC2)cnn1C |
| InChI | InChI=1S/C25H31F3N8O3/c1-16-19(14-33-35(16)2)13-29-20-9-7-17(8-10-20)11-30-23-21(36(37)38)15-32-24(34-23)31-12-18-5-3-4-6-22(18)39-25(26,27)28/h3-6,14-15,17,20,29H,7-13H2,1-2H3,(H2,30,31,32,34) |
| InChIKey | JNYYMHHHSJOQHK-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.57 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|