About 8-[[4-(2,4-difluorophenyl)-1-methylpiperidin-4-yl]methoxymethyl]-6-methylquinoline
8-[[4-(2,4-difluorophenyl)-1-methylpiperidin-4-yl]methoxymethyl]-6-methylquinoline (PubChem CID 25167591) has the molecular formula C24H26F2N2O
and a molecular weight of 396.48 g/mol. Its IUPAC name is 8-[[4-(2,4-difluorophenyl)-1-methylpiperidin-4-yl]methoxymethyl]-6-methylquinoline.
Molecular Properties
| Compound Name | 8-[[4-(2,4-difluorophenyl)-1-methylpiperidin-4-yl]methoxymethyl]-6-methylquinoline |
| PubChem CID | 25167591 |
| Molecular Formula | C24H26F2N2O |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 8-[[4-(2,4-difluorophenyl)-1-methylpiperidin-4-yl]methoxymethyl]-6-methylquinoline |
| SMILES | Cc1cc(COCC2(c3ccc(F)cc3F)CCN(C)CC2)c2ncccc2c1 |
| InChI | InChI=1S/C24H26F2N2O/c1-17-12-18-4-3-9-27-23(18)19(13-17)15-29-16-24(7-10-28(2)11-8-24)21-6-5-20(25)14-22(21)26/h3-6,9,12-14H,7-8,10-11,15-16H2,1-2H3 |
| InChIKey | RYFCLQOFVHTLHE-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-[[4-(2,4-difluorophenyl)-1-methylpiperidin-4-yl]methoxymethyl]-6-methylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[[4-(2,4-difluorophenyl)-1-methylpiperidin-4-yl]methoxymethyl]-6-methylquinoline?
The IUPAC name of 8-[[4-(2,4-difluorophenyl)-1-methylpiperidin-4-yl]methoxymethyl]-6-methylquinoline (CID 25167591) is 8-[[4-(2,4-difluorophenyl)-1-methylpiperidin-4-yl]methoxymethyl]-6-methylquinoline.
What is the SMILES notation for 8-[[4-(2,4-difluorophenyl)-1-methylpiperidin-4-yl]methoxymethyl]-6-methylquinoline?
The canonical SMILES for 8-[[4-(2,4-difluorophenyl)-1-methylpiperidin-4-yl]methoxymethyl]-6-methylquinoline is Cc1cc(COCC2(c3ccc(F)cc3F)CCN(C)CC2)c2ncccc2c1.
What is the InChIKey of 8-[[4-(2,4-difluorophenyl)-1-methylpiperidin-4-yl]methoxymethyl]-6-methylquinoline?
The InChIKey is RYFCLQOFVHTLHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26F2N2O/c1-17-12-18-4-3-9-27-23(18)19(13-17)15-29-16-24(7-10-28(2)11-8-24)21-6-5-20(25)14-22(21)26/h3-6,9,12-14H,7-8,10-11,15-16H2,1-2H3.
What are the key properties of 8-[[4-(2,4-difluorophenyl)-1-methylpiperidin-4-yl]methoxymethyl]-6-methylquinoline?
8-[[4-(2,4-difluorophenyl)-1-methylpiperidin-4-yl]methoxymethyl]-6-methylquinoline has a molecular weight of 396.48 g/mol, XLogP of 5.00, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[[4-(2,4-difluorophenyl)-1-methylpiperidin-4-yl]methoxymethyl]-6-methylquinoline is sourced from PubChem (CID 25167591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).