C18H17F6NO3S — CID 25167684
2,4,6-trimethyl-N-[1,1,1-trifluoro-3-(2,3,6-trifluorophenoxy)propan-2-yl]benzenesulfonamide (PubChem CID 25167684) has the molecular formula C18H17F6NO3S and a molecular weight of 441.39 g/mol. Its IUPAC name is 2,4,6-trimethyl-N-[1,1,1-trifluoro-3-(2,3,6-trifluorophenoxy)propan-2-yl]benzenesulfonamide.
| Compound Name | 2,4,6-trimethyl-N-[1,1,1-trifluoro-3-(2,3,6-trifluorophenoxy)propan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 25167684 |
| Molecular Formula | C18H17F6NO3S |
| Molecular Weight | 441.39 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | 2,4,6-trimethyl-N-[1,1,1-trifluoro-3-(2,3,6-trifluorophenoxy)propan-2-yl]benzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)NC(COc2c(F)ccc(F)c2F)C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C18H17F6NO3S/c1-9-6-10(2)17(11(3)7-9)29(26,27)25-14(18(22,23)24)8-28-16-13(20)5-4-12(19)15(16)21/h4-7,14,25H,8H2,1-3H3 |
| InChIKey | NZZDIQWMIHNFPT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|