C19H24ClFN6O2 — CID 25167843
4-N-[(4-aminocyclohexyl)methyl]-2-N-[(2-chloro-6-fluoro-3-methylphenyl)methyl]-5-nitropyrimidine-2,4-diamine (PubChem CID 25167843) has the molecular formula C19H24ClFN6O2 and a molecular weight of 422.89 g/mol. Its IUPAC name is 4-N-[(4-aminocyclohexyl)methyl]-2-N-[(2-chloro-6-fluoro-3-methylphenyl)methyl]-5-nitropyrimidine-2,4-diamine.
| Compound Name | 4-N-[(4-aminocyclohexyl)methyl]-2-N-[(2-chloro-6-fluoro-3-methylphenyl)methyl]-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 25167843 |
| Molecular Formula | C19H24ClFN6O2 |
| Molecular Weight | 422.89 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 4-N-[(4-aminocyclohexyl)methyl]-2-N-[(2-chloro-6-fluoro-3-methylphenyl)methyl]-5-nitropyrimidine-2,4-diamine |
| SMILES | Cc1ccc(F)c(CNc2ncc([N+](=O)[O-])c(NCC3CCC(N)CC3)n2)c1Cl |
| InChI | InChI=1S/C19H24ClFN6O2/c1-11-2-7-15(21)14(17(11)20)9-24-19-25-10-16(27(28)29)18(26-19)23-8-12-3-5-13(22)6-4-12/h2,7,10,12-13H,3-6,8-9,22H2,1H3,(H2,23,24,25,26) |
| InChIKey | HYYMPVXGLUPOJK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.89 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|