C20H17N3O6 — CID 25167903
21-(2-hydroxyethyl)-16,17-dimethoxy-5,7-dioxa-11,12,21-triazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14,16,18-octaen-20-one (PubChem CID 25167903) has the molecular formula C20H17N3O6 and a molecular weight of 395.37 g/mol. Its IUPAC name is 21-(2-hydroxyethyl)-16,17-dimethoxy-5,7-dioxa-11,12,21-triazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14,16,18-octaen-20-one.
| Compound Name | 21-(2-hydroxyethyl)-16,17-dimethoxy-5,7-dioxa-11,12,21-triazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14,16,18-octaen-20-one |
|---|---|
| PubChem CID | 25167903 |
| Molecular Formula | C20H17N3O6 |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 21-(2-hydroxyethyl)-16,17-dimethoxy-5,7-dioxa-11,12,21-triazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14,16,18-octaen-20-one |
| SMILES | COc1cc2c(=O)n(CCO)c3c4cc5c(cc4nnc3c2cc1OC)OCO5 |
| InChI | InChI=1S/C20H17N3O6/c1-26-14-5-10-11(6-15(14)27-2)20(25)23(3-4-24)19-12-7-16-17(29-9-28-16)8-13(12)21-22-18(10)19/h5-8,24H,3-4,9H2,1-2H3 |
| InChIKey | VGRFSXFDWJAOGM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 104.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|