acetic acid;3,5-dimethyladamantan-1-amine

C14H25NO2 — CID 25168301

IUPACacetic acid;3,5-dimethyladamantan-1-amine
SMILESCC(=O)O.CC12CC3CC(C)(C1)CC(N)(C3)C2
InChIInChI=1S/C12H21N.C2H4O2/c1-10-3-9-4-11(2,6-10)8-12(13,5-9)7-10;1-2(3)4/h9H,3-8,13H2,1-2H3;1H3,(H,3,4)
InChIKeySEILFOQIBMWOKI-UHFFFAOYSA-N
MW239.36 g/mol
LogP2.79
Rot. Bonds

About acetic acid;3,5-dimethyladamantan-1-amine

acetic acid;3,5-dimethyladamantan-1-amine (PubChem CID 25168301) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is acetic acid;3,5-dimethyladamantan-1-amine.

Molecular Properties

Compound Nameacetic acid;3,5-dimethyladamantan-1-amine
PubChem CID25168301
Molecular FormulaC14H25NO2
Molecular Weight239.36 g/mol
Exact Mass239.19
IUPAC Nameacetic acid;3,5-dimethyladamantan-1-amine
SMILESCC(=O)O.CC12CC3CC(C)(C1)CC(N)(C3)C2
InChIInChI=1S/C12H21N.C2H4O2/c1-10-3-9-4-11(2,6-10)8-12(13,5-9)7-10;1-2(3)4/h9H,3-8,13H2,1-2H3;1H3,(H,3,4)
InChIKeySEILFOQIBMWOKI-UHFFFAOYSA-N
XLogP2.79
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.36
LogP ≤ 52.79
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze acetic acid;3,5-dimethyladamantan-1-amine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;3,5-dimethyladamantan-1-amine?
The IUPAC name of acetic acid;3,5-dimethyladamantan-1-amine (CID 25168301) is acetic acid;3,5-dimethyladamantan-1-amine.
What is the SMILES notation for acetic acid;3,5-dimethyladamantan-1-amine?
The canonical SMILES for acetic acid;3,5-dimethyladamantan-1-amine is CC(=O)O.CC12CC3CC(C)(C1)CC(N)(C3)C2.
What is the InChIKey of acetic acid;3,5-dimethyladamantan-1-amine?
The InChIKey is SEILFOQIBMWOKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N.C2H4O2/c1-10-3-9-4-11(2,6-10)8-12(13,5-9)7-10;1-2(3)4/h9H,3-8,13H2,1-2H3;1H3,(H,3,4).
What are the key properties of acetic acid;3,5-dimethyladamantan-1-amine?
acetic acid;3,5-dimethyladamantan-1-amine has a molecular weight of 239.36 g/mol, XLogP of 2.79, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;3,5-dimethyladamantan-1-amine is sourced from PubChem (CID 25168301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).