About 3,5-dimethyladamantan-1-amine;oxalic acid
3,5-dimethyladamantan-1-amine;oxalic acid (PubChem CID 25168430) has the molecular formula C14H23NO4
and a molecular weight of 269.34 g/mol. Its IUPAC name is 3,5-dimethyladamantan-1-amine;oxalic acid.
Molecular Properties
| Compound Name | 3,5-dimethyladamantan-1-amine;oxalic acid |
| PubChem CID | 25168430 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 3,5-dimethyladamantan-1-amine;oxalic acid |
| SMILES | CC12CC3CC(C)(C1)CC(N)(C3)C2.O=C(O)C(=O)O |
| InChI | InChI=1S/C12H21N.C2H2O4/c1-10-3-9-4-11(2,6-10)8-12(13,5-9)7-10;3-1(4)2(5)6/h9H,3-8,13H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | FGDLNJAGEZYBDI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethyladamantan-1-amine;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyladamantan-1-amine;oxalic acid?
The IUPAC name of 3,5-dimethyladamantan-1-amine;oxalic acid (CID 25168430) is 3,5-dimethyladamantan-1-amine;oxalic acid.
What is the SMILES notation for 3,5-dimethyladamantan-1-amine;oxalic acid?
The canonical SMILES for 3,5-dimethyladamantan-1-amine;oxalic acid is CC12CC3CC(C)(C1)CC(N)(C3)C2.O=C(O)C(=O)O.
What is the InChIKey of 3,5-dimethyladamantan-1-amine;oxalic acid?
The InChIKey is FGDLNJAGEZYBDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N.C2H2O4/c1-10-3-9-4-11(2,6-10)8-12(13,5-9)7-10;3-1(4)2(5)6/h9H,3-8,13H2,1-2H3;(H,3,4)(H,5,6).
What are the key properties of 3,5-dimethyladamantan-1-amine;oxalic acid?
3,5-dimethyladamantan-1-amine;oxalic acid has a molecular weight of 269.34 g/mol, XLogP of 1.85, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyladamantan-1-amine;oxalic acid is sourced from PubChem (CID 25168430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).