C17H17Cl2N5O2S — CID 25168577
4-amino-2-butylsulfanyl-8-[(3,4-dichlorophenyl)methyl]-5H-pteridine-6,7-dione (PubChem CID 25168577) has the molecular formula C17H17Cl2N5O2S and a molecular weight of 426.33 g/mol. Its IUPAC name is 4-amino-2-butylsulfanyl-8-[(3,4-dichlorophenyl)methyl]-5H-pteridine-6,7-dione.
| Compound Name | 4-amino-2-butylsulfanyl-8-[(3,4-dichlorophenyl)methyl]-5H-pteridine-6,7-dione |
|---|---|
| PubChem CID | 25168577 |
| Molecular Formula | C17H17Cl2N5O2S |
| Molecular Weight | 426.33 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | 4-amino-2-butylsulfanyl-8-[(3,4-dichlorophenyl)methyl]-5H-pteridine-6,7-dione |
| SMILES | CCCCSc1nc(N)c2[nH]c(=O)c(=O)n(Cc3ccc(Cl)c(Cl)c3)c2n1 |
| InChI | InChI=1S/C17H17Cl2N5O2S/c1-2-3-6-27-17-22-13(20)12-14(23-17)24(16(26)15(25)21-12)8-9-4-5-10(18)11(19)7-9/h4-5,7H,2-3,6,8H2,1H3,(H,21,25)(H2,20,22,23) |
| InChIKey | MUOUONDZFUZNIO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|