C28H32N6OS — CID 25169121
4-[(2-amino-1,3-benzothiazol-6-yl)amino]-7-[3-(3,5-dimethylpiperidin-1-yl)propoxy]-6-methylquinoline-3-carbonitrile (PubChem CID 25169121) has the molecular formula C28H32N6OS and a molecular weight of 500.67 g/mol. Its IUPAC name is 4-[(2-amino-1,3-benzothiazol-6-yl)amino]-7-[3-(3,5-dimethylpiperidin-1-yl)propoxy]-6-methylquinoline-3-carbonitrile.
| Compound Name | 4-[(2-amino-1,3-benzothiazol-6-yl)amino]-7-[3-(3,5-dimethylpiperidin-1-yl)propoxy]-6-methylquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 25169121 |
| Molecular Formula | C28H32N6OS |
| Molecular Weight | 500.67 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | 4-[(2-amino-1,3-benzothiazol-6-yl)amino]-7-[3-(3,5-dimethylpiperidin-1-yl)propoxy]-6-methylquinoline-3-carbonitrile |
| SMILES | Cc1cc2c(Nc3ccc4nc(N)sc4c3)c(C#N)cnc2cc1OCCCN1CC(C)CC(C)C1 |
| InChI | InChI=1S/C28H32N6OS/c1-17-9-18(2)16-34(15-17)7-4-8-35-25-12-24-22(10-19(25)3)27(20(13-29)14-31-24)32-21-5-6-23-26(11-21)36-28(30)33-23/h5-6,10-12,14,17-18H,4,7-9,15-16H2,1-3H3,(H2,30,33)(H,31,32) |
| InChIKey | HSAXWQYNUDKUQV-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 100.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.67 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|