C33H35F3N6O3 — CID 25169188
4-N-[[4-(dibenzylamino)cyclohexyl]methyl]-5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-diamine (PubChem CID 25169188) has the molecular formula C33H35F3N6O3 and a molecular weight of 620.68 g/mol. Its IUPAC name is 4-N-[[4-(dibenzylamino)cyclohexyl]methyl]-5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-[[4-(dibenzylamino)cyclohexyl]methyl]-5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 25169188 |
| Molecular Formula | C33H35F3N6O3 |
| Molecular Weight | 620.68 g/mol |
| Exact Mass | 620.27 |
| IUPAC Name | 4-N-[[4-(dibenzylamino)cyclohexyl]methyl]-5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-diamine |
| SMILES | O=[N+]([O-])c1cnc(NCc2ccccc2OC(F)(F)F)nc1NCC1CCC(N(Cc2ccccc2)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C33H35F3N6O3/c34-33(35,36)45-30-14-8-7-13-27(30)20-38-32-39-21-29(42(43)44)31(40-32)37-19-24-15-17-28(18-16-24)41(22-25-9-3-1-4-10-25)23-26-11-5-2-6-12-26/h1-14,21,24,28H,15-20,22-23H2,(H2,37,38,39,40) |
| InChIKey | YTGBBRVGRKSNFC-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.68 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|