C25H28F3N7O3 — CID 25169190
5-nitro-4-N-[[4-(pyridin-3-ylmethylamino)cyclohexyl]methyl]-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-diamine (PubChem CID 25169190) has the molecular formula C25H28F3N7O3 and a molecular weight of 531.54 g/mol. Its IUPAC name is 5-nitro-4-N-[[4-(pyridin-3-ylmethylamino)cyclohexyl]methyl]-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-nitro-4-N-[[4-(pyridin-3-ylmethylamino)cyclohexyl]methyl]-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 25169190 |
| Molecular Formula | C25H28F3N7O3 |
| Molecular Weight | 531.54 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | 5-nitro-4-N-[[4-(pyridin-3-ylmethylamino)cyclohexyl]methyl]-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-diamine |
| SMILES | O=[N+]([O-])c1cnc(NCc2ccccc2OC(F)(F)F)nc1NCC1CCC(NCc2cccnc2)CC1 |
| InChI | InChI=1S/C25H28F3N7O3/c26-25(27,28)38-22-6-2-1-5-19(22)15-32-24-33-16-21(35(36)37)23(34-24)31-13-17-7-9-20(10-8-17)30-14-18-4-3-11-29-12-18/h1-6,11-12,16-17,20,30H,7-10,13-15H2,(H2,31,32,33,34) |
| InChIKey | IYJFCDWEMDWBAL-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 127.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.54 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|