C31H33F3N8O3 — CID 25169191
4-N-[[4-[bis(pyridin-2-ylmethyl)amino]cyclohexyl]methyl]-5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-diamine (PubChem CID 25169191) has the molecular formula C31H33F3N8O3 and a molecular weight of 622.65 g/mol. Its IUPAC name is 4-N-[[4-[bis(pyridin-2-ylmethyl)amino]cyclohexyl]methyl]-5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-[[4-[bis(pyridin-2-ylmethyl)amino]cyclohexyl]methyl]-5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 25169191 |
| Molecular Formula | C31H33F3N8O3 |
| Molecular Weight | 622.65 g/mol |
| Exact Mass | 622.26 |
| IUPAC Name | 4-N-[[4-[bis(pyridin-2-ylmethyl)amino]cyclohexyl]methyl]-5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-diamine |
| SMILES | O=[N+]([O-])c1cnc(NCc2ccccc2OC(F)(F)F)nc1NCC1CCC(N(Cc2ccccn2)Cc2ccccn2)CC1 |
| InChI | InChI=1S/C31H33F3N8O3/c32-31(33,34)45-28-10-2-1-7-23(28)18-38-30-39-19-27(42(43)44)29(40-30)37-17-22-11-13-26(14-12-22)41(20-24-8-3-5-15-35-24)21-25-9-4-6-16-36-25/h1-10,15-16,19,22,26H,11-14,17-18,20-21H2,(H2,37,38,39,40) |
| InChIKey | OJESDOGLRJJZJO-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 131.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.65 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|