About 3-[3-[[4-(1,3-thiazol-2-yl)pyrimidin-2-yl]amino]-5-(trifluoromethyl)phenoxy]propan-1-ol
3-[3-[[4-(1,3-thiazol-2-yl)pyrimidin-2-yl]amino]-5-(trifluoromethyl)phenoxy]propan-1-ol (PubChem CID 25169256) has the molecular formula C17H15F3N4O2S
and a molecular weight of 396.39 g/mol. Its IUPAC name is 3-[3-[[4-(1,3-thiazol-2-yl)pyrimidin-2-yl]amino]-5-(trifluoromethyl)phenoxy]propan-1-ol.
Molecular Properties
| Compound Name | 3-[3-[[4-(1,3-thiazol-2-yl)pyrimidin-2-yl]amino]-5-(trifluoromethyl)phenoxy]propan-1-ol |
| PubChem CID | 25169256 |
| Molecular Formula | C17H15F3N4O2S |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 3-[3-[[4-(1,3-thiazol-2-yl)pyrimidin-2-yl]amino]-5-(trifluoromethyl)phenoxy]propan-1-ol |
| SMILES | OCCCOc1cc(Nc2nccc(-c3nccs3)n2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H15F3N4O2S/c18-17(19,20)11-8-12(10-13(9-11)26-6-1-5-25)23-16-22-3-2-14(24-16)15-21-4-7-27-15/h2-4,7-10,25H,1,5-6H2,(H,22,23,24) |
| InChIKey | UNGHXZVJQQABCA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 80.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-[[4-(1,3-thiazol-2-yl)pyrimidin-2-yl]amino]-5-(trifluoromethyl)phenoxy]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[[4-(1,3-thiazol-2-yl)pyrimidin-2-yl]amino]-5-(trifluoromethyl)phenoxy]propan-1-ol?
The IUPAC name of 3-[3-[[4-(1,3-thiazol-2-yl)pyrimidin-2-yl]amino]-5-(trifluoromethyl)phenoxy]propan-1-ol (CID 25169256) is 3-[3-[[4-(1,3-thiazol-2-yl)pyrimidin-2-yl]amino]-5-(trifluoromethyl)phenoxy]propan-1-ol.
What is the SMILES notation for 3-[3-[[4-(1,3-thiazol-2-yl)pyrimidin-2-yl]amino]-5-(trifluoromethyl)phenoxy]propan-1-ol?
The canonical SMILES for 3-[3-[[4-(1,3-thiazol-2-yl)pyrimidin-2-yl]amino]-5-(trifluoromethyl)phenoxy]propan-1-ol is OCCCOc1cc(Nc2nccc(-c3nccs3)n2)cc(C(F)(F)F)c1.
What is the InChIKey of 3-[3-[[4-(1,3-thiazol-2-yl)pyrimidin-2-yl]amino]-5-(trifluoromethyl)phenoxy]propan-1-ol?
The InChIKey is UNGHXZVJQQABCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15F3N4O2S/c18-17(19,20)11-8-12(10-13(9-11)26-6-1-5-25)23-16-22-3-2-14(24-16)15-21-4-7-27-15/h2-4,7-10,25H,1,5-6H2,(H,22,23,24).
What are the key properties of 3-[3-[[4-(1,3-thiazol-2-yl)pyrimidin-2-yl]amino]-5-(trifluoromethyl)phenoxy]propan-1-ol?
3-[3-[[4-(1,3-thiazol-2-yl)pyrimidin-2-yl]amino]-5-(trifluoromethyl)phenoxy]propan-1-ol has a molecular weight of 396.39 g/mol, XLogP of 4.12, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[[4-(1,3-thiazol-2-yl)pyrimidin-2-yl]amino]-5-(trifluoromethyl)phenoxy]propan-1-ol is sourced from PubChem (CID 25169256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).