About 6-(6-chloroimidazo[1,2-a]pyridin-3-yl)-N-piperidin-3-ylpyridin-2-amine
6-(6-chloroimidazo[1,2-a]pyridin-3-yl)-N-piperidin-3-ylpyridin-2-amine (PubChem CID 25169384) has the molecular formula C17H18ClN5
and a molecular weight of 327.82 g/mol. Its IUPAC name is 6-(6-chloroimidazo[1,2-a]pyridin-3-yl)-N-piperidin-3-ylpyridin-2-amine.
Molecular Properties
| Compound Name | 6-(6-chloroimidazo[1,2-a]pyridin-3-yl)-N-piperidin-3-ylpyridin-2-amine |
| PubChem CID | 25169384 |
| Molecular Formula | C17H18ClN5 |
| Molecular Weight | 327.82 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 6-(6-chloroimidazo[1,2-a]pyridin-3-yl)-N-piperidin-3-ylpyridin-2-amine |
| SMILES | Clc1ccc2ncc(-c3cccc(NC4CCCNC4)n3)n2c1 |
| InChI | InChI=1S/C17H18ClN5/c18-12-6-7-17-20-10-15(23(17)11-12)14-4-1-5-16(22-14)21-13-3-2-8-19-9-13/h1,4-7,10-11,13,19H,2-3,8-9H2,(H,21,22) |
| InChIKey | SZFYZDIPRMLBDC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 54.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.82 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(6-chloroimidazo[1,2-a]pyridin-3-yl)-N-piperidin-3-ylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(6-chloroimidazo[1,2-a]pyridin-3-yl)-N-piperidin-3-ylpyridin-2-amine?
The IUPAC name of 6-(6-chloroimidazo[1,2-a]pyridin-3-yl)-N-piperidin-3-ylpyridin-2-amine (CID 25169384) is 6-(6-chloroimidazo[1,2-a]pyridin-3-yl)-N-piperidin-3-ylpyridin-2-amine.
What is the SMILES notation for 6-(6-chloroimidazo[1,2-a]pyridin-3-yl)-N-piperidin-3-ylpyridin-2-amine?
The canonical SMILES for 6-(6-chloroimidazo[1,2-a]pyridin-3-yl)-N-piperidin-3-ylpyridin-2-amine is Clc1ccc2ncc(-c3cccc(NC4CCCNC4)n3)n2c1.
What is the InChIKey of 6-(6-chloroimidazo[1,2-a]pyridin-3-yl)-N-piperidin-3-ylpyridin-2-amine?
The InChIKey is SZFYZDIPRMLBDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18ClN5/c18-12-6-7-17-20-10-15(23(17)11-12)14-4-1-5-16(22-14)21-13-3-2-8-19-9-13/h1,4-7,10-11,13,19H,2-3,8-9H2,(H,21,22).
What are the key properties of 6-(6-chloroimidazo[1,2-a]pyridin-3-yl)-N-piperidin-3-ylpyridin-2-amine?
6-(6-chloroimidazo[1,2-a]pyridin-3-yl)-N-piperidin-3-ylpyridin-2-amine has a molecular weight of 327.82 g/mol, XLogP of 3.21, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(6-chloroimidazo[1,2-a]pyridin-3-yl)-N-piperidin-3-ylpyridin-2-amine is sourced from PubChem (CID 25169384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).