C23H28N6O2 — CID 25169385
N-[3-[4-(3,4-dimethylphenyl)piperazin-1-yl]propyl]-3-pyridin-3-yl-1,2,4-oxadiazole-5-carboxamide (PubChem CID 25169385) has the molecular formula C23H28N6O2 and a molecular weight of 420.52 g/mol. Its IUPAC name is N-[3-[4-(3,4-dimethylphenyl)piperazin-1-yl]propyl]-3-pyridin-3-yl-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[3-[4-(3,4-dimethylphenyl)piperazin-1-yl]propyl]-3-pyridin-3-yl-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 25169385 |
| Molecular Formula | C23H28N6O2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | N-[3-[4-(3,4-dimethylphenyl)piperazin-1-yl]propyl]-3-pyridin-3-yl-1,2,4-oxadiazole-5-carboxamide |
| SMILES | Cc1ccc(N2CCN(CCCNC(=O)c3nc(-c4cccnc4)no3)CC2)cc1C |
| InChI | InChI=1S/C23H28N6O2/c1-17-6-7-20(15-18(17)2)29-13-11-28(12-14-29)10-4-9-25-22(30)23-26-21(27-31-23)19-5-3-8-24-16-19/h3,5-8,15-16H,4,9-14H2,1-2H3,(H,25,30) |
| InChIKey | JETDMJVXCWIDCR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|