C8H15NaO8S — CID 25169386
sodium 2-[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]ethanesulfonate (PubChem CID 25169386) has the molecular formula C8H15NaO8S and a molecular weight of 294.26 g/mol. Its IUPAC name is sodium 2-[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]ethanesulfonate.
| Compound Name | sodium 2-[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]ethanesulfonate |
|---|---|
| PubChem CID | 25169386 |
| Molecular Formula | C8H15NaO8S |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | sodium 2-[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]ethanesulfonate |
| SMILES | CO[C@H]1O[C@H](CCS(=O)(=O)[O-])[C@@H](O)[C@H](O)[C@@H]1O.[Na+] |
| InChI | InChI=1S/C8H16O8S.Na/c1-15-8-7(11)6(10)5(9)4(16-8)2-3-17(12,13)14;/h4-11H,2-3H2,1H3,(H,12,13,14);/q;+1/p-1/t4-,5-,6+,7+,8+;/m1./s1 |
| InChIKey | BOKKQCSYWVVONR-CEHJRZNHSA-M |
| XLogP | -5.62 |
| TPSA | 136.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | -5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|