C26H28F4N6O3 — CID 25169458
4-N-[[4-[(2-fluorophenyl)methylamino]cyclohexyl]methyl]-5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-diamine (PubChem CID 25169458) has the molecular formula C26H28F4N6O3 and a molecular weight of 548.54 g/mol. Its IUPAC name is 4-N-[[4-[(2-fluorophenyl)methylamino]cyclohexyl]methyl]-5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-[[4-[(2-fluorophenyl)methylamino]cyclohexyl]methyl]-5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 25169458 |
| Molecular Formula | C26H28F4N6O3 |
| Molecular Weight | 548.54 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | 4-N-[[4-[(2-fluorophenyl)methylamino]cyclohexyl]methyl]-5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-diamine |
| SMILES | O=[N+]([O-])c1cnc(NCc2ccccc2OC(F)(F)F)nc1NCC1CCC(NCc2ccccc2F)CC1 |
| InChI | InChI=1S/C26H28F4N6O3/c27-21-7-3-1-5-18(21)14-31-20-11-9-17(10-12-20)13-32-24-22(36(37)38)16-34-25(35-24)33-15-19-6-2-4-8-23(19)39-26(28,29)30/h1-8,16-17,20,31H,9-15H2,(H2,32,33,34,35) |
| InChIKey | XQKKPUXKESGZBA-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 114.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.54 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|