About tert-butyl N-[(1S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-1-phenylhex-5-en-3-yl]-N-methylcarbamate
tert-butyl N-[(1S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-1-phenylhex-5-en-3-yl]-N-methylcarbamate (PubChem CID 25169627) has the molecular formula C24H41NO3Si
and a molecular weight of 419.68 g/mol. Its IUPAC name is tert-butyl N-[(1S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-1-phenylhex-5-en-3-yl]-N-methylcarbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(1S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-1-phenylhex-5-en-3-yl]-N-methylcarbamate |
| PubChem CID | 25169627 |
| Molecular Formula | C24H41NO3Si |
| Molecular Weight | 419.68 g/mol |
| Exact Mass | 419.29 |
| IUPAC Name | tert-butyl N-[(1S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-1-phenylhex-5-en-3-yl]-N-methylcarbamate |
| SMILES | C=CC[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)c1ccccc1)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H41NO3Si/c1-11-15-20(25(8)22(26)27-23(2,3)4)18-21(19-16-13-12-14-17-19)28-29(9,10)24(5,6)7/h11-14,16-17,20-21H,1,15,18H2,2-10H3/t20-,21+/m1/s1 |
| InChIKey | RNSUHVBKIFRFIZ-RTWAWAEBSA-N |
| XLogP | 6.95 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.68 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(1S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-1-phenylhex-5-en-3-yl]-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(1S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-1-phenylhex-5-en-3-yl]-N-methylcarbamate?
The IUPAC name of tert-butyl N-[(1S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-1-phenylhex-5-en-3-yl]-N-methylcarbamate (CID 25169627) is tert-butyl N-[(1S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-1-phenylhex-5-en-3-yl]-N-methylcarbamate.
What is the SMILES notation for tert-butyl N-[(1S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-1-phenylhex-5-en-3-yl]-N-methylcarbamate?
The canonical SMILES for tert-butyl N-[(1S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-1-phenylhex-5-en-3-yl]-N-methylcarbamate is C=CC[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)c1ccccc1)N(C)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[(1S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-1-phenylhex-5-en-3-yl]-N-methylcarbamate?
The InChIKey is RNSUHVBKIFRFIZ-RTWAWAEBSA-N. The full InChI is InChI=1S/C24H41NO3Si/c1-11-15-20(25(8)22(26)27-23(2,3)4)18-21(19-16-13-12-14-17-19)28-29(9,10)24(5,6)7/h11-14,16-17,20-21H,1,15,18H2,2-10H3/t20-,21+/m1/s1.
What are the key properties of tert-butyl N-[(1S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-1-phenylhex-5-en-3-yl]-N-methylcarbamate?
tert-butyl N-[(1S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-1-phenylhex-5-en-3-yl]-N-methylcarbamate has a molecular weight of 419.68 g/mol, XLogP of 6.95, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(1S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-1-phenylhex-5-en-3-yl]-N-methylcarbamate is sourced from PubChem (CID 25169627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).