C21H32N2O6 — CID 25169696
ditert-butyl (3R,5S)-1,4-dioxo-3-propan-2-yl-2,6-diazaspiro[4.5]dec-8-ene-2,6-dicarboxylate (PubChem CID 25169696) has the molecular formula C21H32N2O6 and a molecular weight of 408.50 g/mol. Its IUPAC name is ditert-butyl (3R,5S)-1,4-dioxo-3-propan-2-yl-2,6-diazaspiro[4.5]dec-8-ene-2,6-dicarboxylate.
| Compound Name | ditert-butyl (3R,5S)-1,4-dioxo-3-propan-2-yl-2,6-diazaspiro[4.5]dec-8-ene-2,6-dicarboxylate |
|---|---|
| PubChem CID | 25169696 |
| Molecular Formula | C21H32N2O6 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | ditert-butyl (3R,5S)-1,4-dioxo-3-propan-2-yl-2,6-diazaspiro[4.5]dec-8-ene-2,6-dicarboxylate |
| SMILES | CC(C)[C@@H]1C(=O)[C@@]2(CC=CCN2C(=O)OC(C)(C)C)C(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H32N2O6/c1-13(2)14-15(24)21(16(25)23(14)18(27)29-20(6,7)8)11-9-10-12-22(21)17(26)28-19(3,4)5/h9-10,13-14H,11-12H2,1-8H3/t14-,21+/m1/s1 |
| InChIKey | LGICYXPOXGISMU-SZNDQCEHSA-N |
| XLogP | 3.29 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|