C27H28ClF3N8O3 — CID 25169765
4-chloro-3-[4-(1,5-dimethylpyrazol-4-yl)triazol-1-yl]-N-[3-[[2-formamidoethyl(methyl)amino]methyl]-2-methoxy-5-(trifluoromethyl)phenyl]benzamide (PubChem CID 25169765) has the molecular formula C27H28ClF3N8O3 and a molecular weight of 605.02 g/mol. Its IUPAC name is 4-chloro-3-[4-(1,5-dimethylpyrazol-4-yl)triazol-1-yl]-N-[3-[[2-formamidoethyl(methyl)amino]methyl]-2-methoxy-5-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-chloro-3-[4-(1,5-dimethylpyrazol-4-yl)triazol-1-yl]-N-[3-[[2-formamidoethyl(methyl)amino]methyl]-2-methoxy-5-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 25169765 |
| Molecular Formula | C27H28ClF3N8O3 |
| Molecular Weight | 605.02 g/mol |
| Exact Mass | 604.19 |
| IUPAC Name | 4-chloro-3-[4-(1,5-dimethylpyrazol-4-yl)triazol-1-yl]-N-[3-[[2-formamidoethyl(methyl)amino]methyl]-2-methoxy-5-(trifluoromethyl)phenyl]benzamide |
| SMILES | COc1c(CN(C)CCNC=O)cc(C(F)(F)F)cc1NC(=O)c1ccc(Cl)c(-n2cc(-c3cnn(C)c3C)nn2)c1 |
| InChI | InChI=1S/C27H28ClF3N8O3/c1-16-20(12-33-38(16)3)23-14-39(36-35-23)24-10-17(5-6-21(24)28)26(41)34-22-11-19(27(29,30)31)9-18(25(22)42-4)13-37(2)8-7-32-15-40/h5-6,9-12,14-15H,7-8,13H2,1-4H3,(H,32,40)(H,34,41) |
| InChIKey | VDJWYCKTAORVDO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 119.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.02 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|