C23H22Cl2N2O — CID 25169992
7-(2,4-dichlorophenyl)-2-hexan-3-yl-10-methyl-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaen-3-one (PubChem CID 25169992) has the molecular formula C23H22Cl2N2O and a molecular weight of 413.35 g/mol. Its IUPAC name is 7-(2,4-dichlorophenyl)-2-hexan-3-yl-10-methyl-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaen-3-one.
| Compound Name | 7-(2,4-dichlorophenyl)-2-hexan-3-yl-10-methyl-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaen-3-one |
|---|---|
| PubChem CID | 25169992 |
| Molecular Formula | C23H22Cl2N2O |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 7-(2,4-dichlorophenyl)-2-hexan-3-yl-10-methyl-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaen-3-one |
| SMILES | CCCC(CC)N1C(=O)c2ccc(-c3ccc(Cl)cc3Cl)c3nc(C)cc1c23 |
| InChI | InChI=1S/C23H22Cl2N2O/c1-4-6-15(5-2)27-20-11-13(3)26-22-17(9-10-18(21(20)22)23(27)28)16-8-7-14(24)12-19(16)25/h7-12,15H,4-6H2,1-3H3 |
| InChIKey | VHSAFPMSSGFTCM-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |