C14H30O3Si — CID 25170041
(Z,2S,3R,4S)-3-(methoxymethoxy)-2,4-dimethyl-6-trimethylsilylhept-5-en-1-ol (PubChem CID 25170041) has the molecular formula C14H30O3Si and a molecular weight of 274.48 g/mol. Its IUPAC name is (Z,2S,3R,4S)-3-(methoxymethoxy)-2,4-dimethyl-6-trimethylsilylhept-5-en-1-ol.
| Compound Name | (Z,2S,3R,4S)-3-(methoxymethoxy)-2,4-dimethyl-6-trimethylsilylhept-5-en-1-ol |
|---|---|
| PubChem CID | 25170041 |
| Molecular Formula | C14H30O3Si |
| Molecular Weight | 274.48 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | (Z,2S,3R,4S)-3-(methoxymethoxy)-2,4-dimethyl-6-trimethylsilylhept-5-en-1-ol |
| SMILES | COCO[C@H]([C@@H](C)/C=C(/C)[Si](C)(C)C)[C@@H](C)CO |
| InChI | InChI=1S/C14H30O3Si/c1-11(8-13(3)18(5,6)7)14(12(2)9-15)17-10-16-4/h8,11-12,14-15H,9-10H2,1-7H3/b13-8-/t11-,12-,14+/m0/s1 |
| InChIKey | VBWWTSVUUSNZHL-LKBWDGANSA-N |
| XLogP | 3.06 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|