About [(3R)-4-amino-3-cyano-2-oxopent-4-enyl] 3-oxo-4H-1,4-benzothiazine-6-carboxylate
[(3R)-4-amino-3-cyano-2-oxopent-4-enyl] 3-oxo-4H-1,4-benzothiazine-6-carboxylate (PubChem CID 2517007) has the molecular formula C15H13N3O4S
and a molecular weight of 331.35 g/mol. Its IUPAC name is [(3R)-4-amino-3-cyano-2-oxopent-4-enyl] 3-oxo-4H-1,4-benzothiazine-6-carboxylate.
Molecular Properties
| Compound Name | [(3R)-4-amino-3-cyano-2-oxopent-4-enyl] 3-oxo-4H-1,4-benzothiazine-6-carboxylate |
| PubChem CID | 2517007 |
| Molecular Formula | C15H13N3O4S |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | [(3R)-4-amino-3-cyano-2-oxopent-4-enyl] 3-oxo-4H-1,4-benzothiazine-6-carboxylate |
| SMILES | C=C(N)[C@H](C#N)C(=O)COC(=O)c1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C15H13N3O4S/c1-8(17)10(5-16)12(19)6-22-15(21)9-2-3-13-11(4-9)18-14(20)7-23-13/h2-4,10H,1,6-7,17H2,(H,18,20)/t10-/m0/s1 |
| InChIKey | KHBZQGKZVISOQB-JTQLQIEISA-N |
| XLogP | 1.07 |
| TPSA | 122.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [(3R)-4-amino-3-cyano-2-oxopent-4-enyl] 3-oxo-4H-1,4-benzothiazine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-4-amino-3-cyano-2-oxopent-4-enyl] 3-oxo-4H-1,4-benzothiazine-6-carboxylate?
The IUPAC name of [(3R)-4-amino-3-cyano-2-oxopent-4-enyl] 3-oxo-4H-1,4-benzothiazine-6-carboxylate (CID 2517007) is [(3R)-4-amino-3-cyano-2-oxopent-4-enyl] 3-oxo-4H-1,4-benzothiazine-6-carboxylate.
What is the SMILES notation for [(3R)-4-amino-3-cyano-2-oxopent-4-enyl] 3-oxo-4H-1,4-benzothiazine-6-carboxylate?
The canonical SMILES for [(3R)-4-amino-3-cyano-2-oxopent-4-enyl] 3-oxo-4H-1,4-benzothiazine-6-carboxylate is C=C(N)[C@H](C#N)C(=O)COC(=O)c1ccc2c(c1)NC(=O)CS2.
What is the InChIKey of [(3R)-4-amino-3-cyano-2-oxopent-4-enyl] 3-oxo-4H-1,4-benzothiazine-6-carboxylate?
The InChIKey is KHBZQGKZVISOQB-JTQLQIEISA-N. The full InChI is InChI=1S/C15H13N3O4S/c1-8(17)10(5-16)12(19)6-22-15(21)9-2-3-13-11(4-9)18-14(20)7-23-13/h2-4,10H,1,6-7,17H2,(H,18,20)/t10-/m0/s1.
What are the key properties of [(3R)-4-amino-3-cyano-2-oxopent-4-enyl] 3-oxo-4H-1,4-benzothiazine-6-carboxylate?
[(3R)-4-amino-3-cyano-2-oxopent-4-enyl] 3-oxo-4H-1,4-benzothiazine-6-carboxylate has a molecular weight of 331.35 g/mol, XLogP of 1.07, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-4-amino-3-cyano-2-oxopent-4-enyl] 3-oxo-4H-1,4-benzothiazine-6-carboxylate is sourced from PubChem (CID 2517007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).