C28H34N2O4 — CID 25170155
(1R,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11-[(4-phenylphenyl)methylamino]-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one (PubChem CID 25170155) has the molecular formula C28H34N2O4 and a molecular weight of 462.59 g/mol. Its IUPAC name is (1R,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11-[(4-phenylphenyl)methylamino]-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one.
| Compound Name | (1R,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11-[(4-phenylphenyl)methylamino]-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one |
|---|---|
| PubChem CID | 25170155 |
| Molecular Formula | C28H34N2O4 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | (1R,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11-[(4-phenylphenyl)methylamino]-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one |
| SMILES | C[C@@H]1CC[C@H]2[C@@H](C)C(=O)N(NCc3ccc(-c4ccccc4)cc3)[C@@H]3O[C@@]4(C)CC[C@@H]1[C@@]23OO4 |
| InChI | InChI=1S/C28H34N2O4/c1-18-9-14-24-19(2)25(31)30(26-28(24)23(18)15-16-27(3,32-26)33-34-28)29-17-20-10-12-22(13-11-20)21-7-5-4-6-8-21/h4-8,10-13,18-19,23-24,26,29H,9,14-17H2,1-3H3/t18-,19-,23+,24+,26-,27-,28-/m1/s1 |
| InChIKey | NCAMFZHGFDTAPJ-ZZVFUPHRSA-N |
| XLogP | 5.05 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|