C22H29NO5 — CID 25170156
(1R,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11-phenylmethoxy-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one (PubChem CID 25170156) has the molecular formula C22H29NO5 and a molecular weight of 387.48 g/mol. Its IUPAC name is (1R,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11-phenylmethoxy-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one.
| Compound Name | (1R,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11-phenylmethoxy-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one |
|---|---|
| PubChem CID | 25170156 |
| Molecular Formula | C22H29NO5 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | (1R,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11-phenylmethoxy-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one |
| SMILES | C[C@@H]1CC[C@H]2[C@@H](C)C(=O)N(OCc3ccccc3)[C@@H]3O[C@@]4(C)CC[C@@H]1[C@@]23OO4 |
| InChI | InChI=1S/C22H29NO5/c1-14-9-10-18-15(2)19(24)23(25-13-16-7-5-4-6-8-16)20-22(18)17(14)11-12-21(3,26-20)27-28-22/h4-8,14-15,17-18,20H,9-13H2,1-3H3/t14-,15-,17+,18+,20-,21-,22-/m1/s1 |
| InChIKey | UGSWVJYSINAWSJ-PXYXXOMASA-N |
| XLogP | 3.81 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|