C20H21F5N6O2 — CID 25170179
6-amino-2-(2,2,3,3,3-pentafluoropropoxy)-9-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]-7H-purin-8-one (PubChem CID 25170179) has the molecular formula C20H21F5N6O2 and a molecular weight of 472.42 g/mol. Its IUPAC name is 6-amino-2-(2,2,3,3,3-pentafluoropropoxy)-9-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]-7H-purin-8-one.
| Compound Name | 6-amino-2-(2,2,3,3,3-pentafluoropropoxy)-9-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 25170179 |
| Molecular Formula | C20H21F5N6O2 |
| Molecular Weight | 472.42 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 6-amino-2-(2,2,3,3,3-pentafluoropropoxy)-9-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]-7H-purin-8-one |
| SMILES | Nc1nc(OCC(F)(F)C(F)(F)F)nc2c1[nH]c(=O)n2Cc1cccc(CN2CCCC2)c1 |
| InChI | InChI=1S/C20H21F5N6O2/c21-19(22,20(23,24)25)11-33-17-28-15(26)14-16(29-17)31(18(32)27-14)10-13-5-3-4-12(8-13)9-30-6-1-2-7-30/h3-5,8H,1-2,6-7,9-11H2,(H,27,32)(H2,26,28,29) |
| InChIKey | WLKORRSQPYOYAG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|