C38H50O5 — CID 25170291
(1R,3E,5S,6S,7R)-3-[hydroxy-(3-hydroxyphenyl)methylidene]-6-methyl-1,5,7-tris(3-methylbut-2-enyl)-6-(4-methylpent-3-enyl)bicyclo[3.3.1]nonane-2,4,9-trione (PubChem CID 25170291) has the molecular formula C38H50O5 and a molecular weight of 586.81 g/mol. Its IUPAC name is (1R,3E,5S,6S,7R)-3-[hydroxy-(3-hydroxyphenyl)methylidene]-6-methyl-1,5,7-tris(3-methylbut-2-enyl)-6-(4-methylpent-3-enyl)bicyclo[3.3.1]nonane-2,4,9-trione.
| Compound Name | (1R,3E,5S,6S,7R)-3-[hydroxy-(3-hydroxyphenyl)methylidene]-6-methyl-1,5,7-tris(3-methylbut-2-enyl)-6-(4-methylpent-3-enyl)bicyclo[3.3.1]nonane-2,4,9-trione |
|---|---|
| PubChem CID | 25170291 |
| Molecular Formula | C38H50O5 |
| Molecular Weight | 586.81 g/mol |
| Exact Mass | 586.37 |
| IUPAC Name | (1R,3E,5S,6S,7R)-3-[hydroxy-(3-hydroxyphenyl)methylidene]-6-methyl-1,5,7-tris(3-methylbut-2-enyl)-6-(4-methylpent-3-enyl)bicyclo[3.3.1]nonane-2,4,9-trione |
| SMILES | CC(C)=CCC[C@@]1(C)[C@H](CC=C(C)C)C[C@@]2(CC=C(C)C)C(=O)/C(=C(\O)c3cccc(O)c3)C(=O)[C@]1(CC=C(C)C)C2=O |
| InChI | InChI=1S/C38H50O5/c1-24(2)12-11-19-36(9)29(16-15-25(3)4)23-37(20-17-26(5)6)33(41)31(32(40)28-13-10-14-30(39)22-28)34(42)38(36,35(37)43)21-18-27(7)8/h10,12-15,17-18,22,29,39-40H,11,16,19-21,23H2,1-9H3/b32-31+/t29-,36+,37+,38-/m1/s1 |
| InChIKey | JBEXIOMALXGGLT-BWUXUIOHSA-N |
| XLogP | 9.20 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.81 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|