C19H36O6Si — CID 25170825
2,2-dimethylpropanoyl (2S,3S)-3-methoxy-5-methyl-2-(2-trimethylsilylethoxymethoxy)hex-5-enoate (PubChem CID 25170825) has the molecular formula C19H36O6Si and a molecular weight of 388.58 g/mol. Its IUPAC name is 2,2-dimethylpropanoyl (2S,3S)-3-methoxy-5-methyl-2-(2-trimethylsilylethoxymethoxy)hex-5-enoate.
| Compound Name | 2,2-dimethylpropanoyl (2S,3S)-3-methoxy-5-methyl-2-(2-trimethylsilylethoxymethoxy)hex-5-enoate |
|---|---|
| PubChem CID | 25170825 |
| Molecular Formula | C19H36O6Si |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 2,2-dimethylpropanoyl (2S,3S)-3-methoxy-5-methyl-2-(2-trimethylsilylethoxymethoxy)hex-5-enoate |
| SMILES | C=C(C)C[C@H](OC)[C@H](OCOCC[Si](C)(C)C)C(=O)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C19H36O6Si/c1-14(2)12-15(22-6)16(17(20)25-18(21)19(3,4)5)24-13-23-10-11-26(7,8)9/h15-16H,1,10-13H2,2-9H3/t15-,16-/m0/s1 |
| InChIKey | AMAUYZOGDYZGKO-HOTGVXAUSA-N |
| XLogP | 3.78 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|