C18H25F3N2O5 — CID 25170934
(2R)-2,4-dihydroxy-3,3-dimethyl-N-[4-oxo-4-[[4-(trifluoromethoxy)phenyl]methylamino]butyl]butanamide (PubChem CID 25170934) has the molecular formula C18H25F3N2O5 and a molecular weight of 406.40 g/mol. Its IUPAC name is (2R)-2,4-dihydroxy-3,3-dimethyl-N-[4-oxo-4-[[4-(trifluoromethoxy)phenyl]methylamino]butyl]butanamide.
| Compound Name | (2R)-2,4-dihydroxy-3,3-dimethyl-N-[4-oxo-4-[[4-(trifluoromethoxy)phenyl]methylamino]butyl]butanamide |
|---|---|
| PubChem CID | 25170934 |
| Molecular Formula | C18H25F3N2O5 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | (2R)-2,4-dihydroxy-3,3-dimethyl-N-[4-oxo-4-[[4-(trifluoromethoxy)phenyl]methylamino]butyl]butanamide |
| SMILES | CC(C)(CO)[C@@H](O)C(=O)NCCCC(=O)NCc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H25F3N2O5/c1-17(2,11-24)15(26)16(27)22-9-3-4-14(25)23-10-12-5-7-13(8-6-12)28-18(19,20)21/h5-8,15,24,26H,3-4,9-11H2,1-2H3,(H,22,27)(H,23,25)/t15-/m0/s1 |
| InChIKey | JGQAOGZJVVESMF-HNNXBMFYSA-N |
| XLogP | 1.48 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|