C18H19BN2O3 — CID 25171121
1-[(3aR,7aS)-2-[2-[(1R)-1-methoxyethyl]phenyl]-3a,7a-dihydro-1,3,2-benzodioxaborol-4-yl]pyrazole (PubChem CID 25171121) has the molecular formula C18H19BN2O3 and a molecular weight of 322.17 g/mol. Its IUPAC name is 1-[(3aR,7aS)-2-[2-[(1R)-1-methoxyethyl]phenyl]-3a,7a-dihydro-1,3,2-benzodioxaborol-4-yl]pyrazole.
| Compound Name | 1-[(3aR,7aS)-2-[2-[(1R)-1-methoxyethyl]phenyl]-3a,7a-dihydro-1,3,2-benzodioxaborol-4-yl]pyrazole |
|---|---|
| PubChem CID | 25171121 |
| Molecular Formula | C18H19BN2O3 |
| Molecular Weight | 322.17 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 1-[(3aR,7aS)-2-[2-[(1R)-1-methoxyethyl]phenyl]-3a,7a-dihydro-1,3,2-benzodioxaborol-4-yl]pyrazole |
| SMILES | CO[C@H](C)c1ccccc1B1O[C@H]2C=CC=C(n3cccn3)[C@H]2O1 |
| InChI | InChI=1S/C18H19BN2O3/c1-13(22-2)14-7-3-4-8-15(14)19-23-17-10-5-9-16(18(17)24-19)21-12-6-11-20-21/h3-13,17-18H,1-2H3/t13-,17+,18-/m1/s1 |
| InChIKey | IAELIHVMQAVHED-JEBQAFNWSA-N |
| XLogP | 2.18 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.17 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|