C12H24N2O4S — CID 25171165
(2R)-N-[2-(2-ethylsulfanylethylamino)-2-oxoethyl]-2,4-dihydroxy-3,3-dimethylbutanamide (PubChem CID 25171165) has the molecular formula C12H24N2O4S and a molecular weight of 292.40 g/mol. Its IUPAC name is (2R)-N-[2-(2-ethylsulfanylethylamino)-2-oxoethyl]-2,4-dihydroxy-3,3-dimethylbutanamide.
| Compound Name | (2R)-N-[2-(2-ethylsulfanylethylamino)-2-oxoethyl]-2,4-dihydroxy-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 25171165 |
| Molecular Formula | C12H24N2O4S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | (2R)-N-[2-(2-ethylsulfanylethylamino)-2-oxoethyl]-2,4-dihydroxy-3,3-dimethylbutanamide |
| SMILES | CCSCCNC(=O)CNC(=O)[C@H](O)C(C)(C)CO |
| InChI | InChI=1S/C12H24N2O4S/c1-4-19-6-5-13-9(16)7-14-11(18)10(17)12(2,3)8-15/h10,15,17H,4-8H2,1-3H3,(H,13,16)(H,14,18)/t10-/m0/s1 |
| InChIKey | DHVBZXHFUDNNKM-JTQLQIEISA-N |
| XLogP | -0.65 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|